C24H28N4OS — CID 155967280
3-(imidazol-1-ylmethyl)-N-[4-(2-piperidin-1-ylethylsulfanyl)phenyl]benzamide (PubChem CID 155967280) has the molecular formula C24H28N4OS and a molecular weight of 420.58 g/mol. Its IUPAC name is 3-(imidazol-1-ylmethyl)-N-[4-(2-piperidin-1-ylethylsulfanyl)phenyl]benzamide.
| Compound Name | 3-(imidazol-1-ylmethyl)-N-[4-(2-piperidin-1-ylethylsulfanyl)phenyl]benzamide |
|---|---|
| PubChem CID | 155967280 |
| Molecular Formula | C24H28N4OS |
| Molecular Weight | 420.58 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | 3-(imidazol-1-ylmethyl)-N-[4-(2-piperidin-1-ylethylsulfanyl)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(SCCN2CCCCC2)cc1)c1cccc(Cn2ccnc2)c1 |
| InChI | InChI=1S/C24H28N4OS/c29-24(21-6-4-5-20(17-21)18-28-14-11-25-19-28)26-22-7-9-23(10-8-22)30-16-15-27-12-2-1-3-13-27/h4-11,14,17,19H,1-3,12-13,15-16,18H2,(H,26,29) |
| InChIKey | CINLPCRZDMKJTG-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.58 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |