C20H22N4O3S — CID 86871548
1-[[3-(imidazol-1-ylmethyl)phenyl]methyl]-3-[3-(methylsulfonylmethyl)phenyl]urea (PubChem CID 86871548) has the molecular formula C20H22N4O3S and a molecular weight of 398.49 g/mol. Its IUPAC name is 1-[[3-(imidazol-1-ylmethyl)phenyl]methyl]-3-[3-(methylsulfonylmethyl)phenyl]urea.
| Compound Name | 1-[[3-(imidazol-1-ylmethyl)phenyl]methyl]-3-[3-(methylsulfonylmethyl)phenyl]urea |
|---|---|
| PubChem CID | 86871548 |
| Molecular Formula | C20H22N4O3S |
| Molecular Weight | 398.49 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | 1-[[3-(imidazol-1-ylmethyl)phenyl]methyl]-3-[3-(methylsulfonylmethyl)phenyl]urea |
| SMILES | CS(=O)(=O)Cc1cccc(NC(=O)NCc2cccc(Cn3ccnc3)c2)c1 |
| InChI | InChI=1S/C20H22N4O3S/c1-28(26,27)14-18-6-3-7-19(11-18)23-20(25)22-12-16-4-2-5-17(10-16)13-24-9-8-21-15-24/h2-11,15H,12-14H2,1H3,(H2,22,23,25) |
| InChIKey | BDKQKPCRNSEANQ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.49 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |