C9H18N4 — CID 143492573
4-(3-methylbutyl)-1H-pyrimidine-2,4-diamine (PubChem CID 143492573) has the molecular formula C9H18N4 and a molecular weight of 182.27 g/mol. Its IUPAC name is 4-(3-methylbutyl)-1H-pyrimidine-2,4-diamine.
| Compound Name | 4-(3-methylbutyl)-1H-pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 143492573 |
| Molecular Formula | C9H18N4 |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.15 |
| IUPAC Name | 4-(3-methylbutyl)-1H-pyrimidine-2,4-diamine |
| SMILES | CC(C)CCC1(N)C=CNC(N)=N1 |
| InChI | InChI=1S/C9H18N4/c1-7(2)3-4-9(11)5-6-12-8(10)13-9/h5-7H,3-4,11H2,1-2H3,(H3,10,12,13) |
| InChIKey | DLLQXIUNCCTZOA-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |