C18H26BrF3N2 — CID 143494116
3-bromo-N-ethyl-N-[(4-propylcyclohexyl)methyl]-5-(trifluoromethyl)pyridin-2-amine (PubChem CID 143494116) has the molecular formula C18H26BrF3N2 and a molecular weight of 407.32 g/mol. Its IUPAC name is 3-bromo-N-ethyl-N-[(4-propylcyclohexyl)methyl]-5-(trifluoromethyl)pyridin-2-amine.
| Compound Name | 3-bromo-N-ethyl-N-[(4-propylcyclohexyl)methyl]-5-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 143494116 |
| Molecular Formula | C18H26BrF3N2 |
| Molecular Weight | 407.32 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | 3-bromo-N-ethyl-N-[(4-propylcyclohexyl)methyl]-5-(trifluoromethyl)pyridin-2-amine |
| SMILES | CCCC1CCC(CN(CC)c2ncc(C(F)(F)F)cc2Br)CC1 |
| InChI | InChI=1S/C18H26BrF3N2/c1-3-5-13-6-8-14(9-7-13)12-24(4-2)17-16(19)10-15(11-23-17)18(20,21)22/h10-11,13-14H,3-9,12H2,1-2H3 |
| InChIKey | MLVPIQMCMJOIHF-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.32 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |