C9H10BrF3N2 — CID 163894256
3-bromo-N-ethyl-N-methyl-5-(trifluoromethyl)pyridin-2-amine (PubChem CID 163894256) has the molecular formula C9H10BrF3N2 and a molecular weight of 283.09 g/mol. Its IUPAC name is 3-bromo-N-ethyl-N-methyl-5-(trifluoromethyl)pyridin-2-amine.
| Compound Name | 3-bromo-N-ethyl-N-methyl-5-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 163894256 |
| Molecular Formula | C9H10BrF3N2 |
| Molecular Weight | 283.09 g/mol |
| Exact Mass | 282.00 |
| IUPAC Name | 3-bromo-N-ethyl-N-methyl-5-(trifluoromethyl)pyridin-2-amine |
| SMILES | CCN(C)c1ncc(C(F)(F)F)cc1Br |
| InChI | InChI=1S/C9H10BrF3N2/c1-3-15(2)8-7(10)4-6(5-14-8)9(11,12)13/h4-5H,3H2,1-2H3 |
| InChIKey | QEFDIBQZZSVRRD-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.09 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |