C30H40FN7O — CID 143495582
[1-[(2-amino-4-pyridinyl)methyl]piperidin-4-yl]-[4-(7-prop-2-enyl-2,7,8-triazabicyclo[4.2.0]octa-1(6),2,4-trien-8-yl)piperidin-1-yl]methanone;(3E)-4-fluoropenta-1,3-diene (PubChem CID 143495582) has the molecular formula C30H40FN7O and a molecular weight of 533.70 g/mol. Its IUPAC name is [1-[(2-amino-4-pyridinyl)methyl]piperidin-4-yl]-[4-(7-prop-2-enyl-2,7,8-triazabicyclo[4.2.0]octa-1(6),2,4-trien-8-yl)piperidin-1-yl]methanone;(3E)-4-fluoropenta-1,3-diene.
| Compound Name | [1-[(2-amino-4-pyridinyl)methyl]piperidin-4-yl]-[4-(7-prop-2-enyl-2,7,8-triazabicyclo[4.2.0]octa-1(6),2,4-trien-8-yl)piperidin-1-yl]methanone;(3E)-4-fluoropenta-1,3-diene |
|---|---|
| PubChem CID | 143495582 |
| Molecular Formula | C30H40FN7O |
| Molecular Weight | 533.70 g/mol |
| Exact Mass | 533.33 |
| IUPAC Name | [1-[(2-amino-4-pyridinyl)methyl]piperidin-4-yl]-[4-(7-prop-2-enyl-2,7,8-triazabicyclo[4.2.0]octa-1(6),2,4-trien-8-yl)piperidin-1-yl]methanone;(3E)-4-fluoropenta-1,3-diene |
| SMILES | C=C/C=C(\C)F.C=CCn1c2cccnc2n1C1CCN(C(=O)C2CCN(Cc3ccnc(N)c3)CC2)CC1 |
| InChI | InChI=1S/C25H33N7O.C5H7F/c1-2-12-31-22-4-3-10-28-24(22)32(31)21-8-15-30(16-9-21)25(33)20-6-13-29(14-7-20)18-19-5-11-27-23(26)17-19;1-3-4-5(2)6/h2-5,10-11,17,20-21H,1,6-9,12-16,18H2,(H2,26,27);3-4H,1H2,2H3/b;5-4+ |
| InChIKey | JFTBDLQBBUTCGB-RCKHEGBHSA-N |
| XLogP | 5.12 |
| TPSA | 85.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.70 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|