C26H34ClN5O2 — CID 21306782
[1-[(2-amino-4-pyridinyl)methyl]piperidin-4-yl]-[4-[(E)-C-(4-chlorophenyl)-N-ethoxycarbonimidoyl]piperidin-1-yl]methanone (PubChem CID 21306782) has the molecular formula C26H34ClN5O2 and a molecular weight of 484.04 g/mol. Its IUPAC name is [1-[(2-amino-4-pyridinyl)methyl]piperidin-4-yl]-[4-[(E)-C-(4-chlorophenyl)-N-ethoxycarbonimidoyl]piperidin-1-yl]methanone.
| Compound Name | [1-[(2-amino-4-pyridinyl)methyl]piperidin-4-yl]-[4-[(E)-C-(4-chlorophenyl)-N-ethoxycarbonimidoyl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 21306782 |
| Molecular Formula | C26H34ClN5O2 |
| Molecular Weight | 484.04 g/mol |
| Exact Mass | 483.24 |
| IUPAC Name | [1-[(2-amino-4-pyridinyl)methyl]piperidin-4-yl]-[4-[(E)-C-(4-chlorophenyl)-N-ethoxycarbonimidoyl]piperidin-1-yl]methanone |
| SMILES | CCO/N=C(/c1ccc(Cl)cc1)C1CCN(C(=O)C2CCN(Cc3ccnc(N)c3)CC2)CC1 |
| InChI | InChI=1S/C26H34ClN5O2/c1-2-34-30-25(20-3-5-23(27)6-4-20)21-10-15-32(16-11-21)26(33)22-8-13-31(14-9-22)18-19-7-12-29-24(28)17-19/h3-7,12,17,21-22H,2,8-11,13-16,18H2,1H3,(H2,28,29)/b30-25- |
| InChIKey | BIOBNUNNQANFRC-JVCXMKTPSA-N |
| XLogP | 4.21 |
| TPSA | 84.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.04 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|