C23H31N7O2 — CID 10296831
[1-[(2-amino-4-pyridinyl)methyl]piperidin-4-yl]-[4-[(E)-N-methoxy-C-pyrazin-2-ylcarbonimidoyl]piperidin-1-yl]methanone (PubChem CID 10296831) has the molecular formula C23H31N7O2 and a molecular weight of 437.55 g/mol. Its IUPAC name is [1-[(2-amino-4-pyridinyl)methyl]piperidin-4-yl]-[4-[(E)-N-methoxy-C-pyrazin-2-ylcarbonimidoyl]piperidin-1-yl]methanone.
| Compound Name | [1-[(2-amino-4-pyridinyl)methyl]piperidin-4-yl]-[4-[(E)-N-methoxy-C-pyrazin-2-ylcarbonimidoyl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 10296831 |
| Molecular Formula | C23H31N7O2 |
| Molecular Weight | 437.55 g/mol |
| Exact Mass | 437.25 |
| IUPAC Name | [1-[(2-amino-4-pyridinyl)methyl]piperidin-4-yl]-[4-[(E)-N-methoxy-C-pyrazin-2-ylcarbonimidoyl]piperidin-1-yl]methanone |
| SMILES | CO/N=C(/c1cnccn1)C1CCN(C(=O)C2CCN(Cc3ccnc(N)c3)CC2)CC1 |
| InChI | InChI=1S/C23H31N7O2/c1-32-28-22(20-15-25-8-9-26-20)18-5-12-30(13-6-18)23(31)19-3-10-29(11-4-19)16-17-2-7-27-21(24)14-17/h2,7-9,14-15,18-19H,3-6,10-13,16H2,1H3,(H2,24,27)/b28-22+ |
| InChIKey | YJRURGDKBIEPEZ-XAYXJRQQSA-N |
| XLogP | 1.96 |
| TPSA | 109.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.55 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|