C26H39FN6O2 — CID 172965775
[1-[(2-amino-4-pyridinyl)methyl]-4-fluoropiperidin-4-yl]-[4-[(E)-N-methoxy-C-pyridin-2-ylcarbonimidoyl]piperidin-1-yl]methanone;methane (PubChem CID 172965775) has the molecular formula C26H39FN6O2 and a molecular weight of 486.64 g/mol. Its IUPAC name is [1-[(2-amino-4-pyridinyl)methyl]-4-fluoropiperidin-4-yl]-[4-[(E)-N-methoxy-C-pyridin-2-ylcarbonimidoyl]piperidin-1-yl]methanone;methane.
| Compound Name | [1-[(2-amino-4-pyridinyl)methyl]-4-fluoropiperidin-4-yl]-[4-[(E)-N-methoxy-C-pyridin-2-ylcarbonimidoyl]piperidin-1-yl]methanone;methane |
|---|---|
| PubChem CID | 172965775 |
| Molecular Formula | C26H39FN6O2 |
| Molecular Weight | 486.64 g/mol |
| Exact Mass | 486.31 |
| IUPAC Name | [1-[(2-amino-4-pyridinyl)methyl]-4-fluoropiperidin-4-yl]-[4-[(E)-N-methoxy-C-pyridin-2-ylcarbonimidoyl]piperidin-1-yl]methanone;methane |
| SMILES | C.C.CO/N=C(/c1ccccn1)C1CCN(C(=O)C2(F)CCN(Cc3ccnc(N)c3)CC2)CC1 |
| InChI | InChI=1S/C24H31FN6O2.2CH4/c1-33-29-22(20-4-2-3-10-27-20)19-6-12-31(13-7-19)23(32)24(25)8-14-30(15-9-24)17-18-5-11-28-21(26)16-18;;/h2-5,10-11,16,19H,6-9,12-15,17H2,1H3,(H2,26,28);2*1H4/b29-22+;; |
| InChIKey | BYFRBLRAOKSAFJ-OXQCRSEHSA-N |
| XLogP | 3.92 |
| TPSA | 96.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.64 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|