C23H31N5O2S — CID 59275029
[1-[(2-amino-4-pyridinyl)methyl]piperidin-4-yl]-[4-(N-methoxy-C-thiophen-3-ylcarbonimidoyl)piperidin-1-yl]methanone (PubChem CID 59275029) has the molecular formula C23H31N5O2S and a molecular weight of 441.60 g/mol. Its IUPAC name is [1-[(2-amino-4-pyridinyl)methyl]piperidin-4-yl]-[4-(N-methoxy-C-thiophen-3-ylcarbonimidoyl)piperidin-1-yl]methanone.
| Compound Name | [1-[(2-amino-4-pyridinyl)methyl]piperidin-4-yl]-[4-(N-methoxy-C-thiophen-3-ylcarbonimidoyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 59275029 |
| Molecular Formula | C23H31N5O2S |
| Molecular Weight | 441.60 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | [1-[(2-amino-4-pyridinyl)methyl]piperidin-4-yl]-[4-(N-methoxy-C-thiophen-3-ylcarbonimidoyl)piperidin-1-yl]methanone |
| SMILES | CON=C(c1ccsc1)C1CCN(C(=O)C2CCN(Cc3ccnc(N)c3)CC2)CC1 |
| InChI | InChI=1S/C23H31N5O2S/c1-30-26-22(20-7-13-31-16-20)18-5-11-28(12-6-18)23(29)19-3-9-27(10-4-19)15-17-2-8-25-21(24)14-17/h2,7-8,13-14,16,18-19H,3-6,9-12,15H2,1H3,(H2,24,25) |
| InChIKey | NSSKFMQUKUIEKE-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 84.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.60 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|