C25H31F3N6O2 — CID 72642300
[1-[(2-amino-4-pyridinyl)methyl]piperidin-4-yl]-[4-[C-pyridin-2-yl-N-(2,2,2-trifluoroethoxy)carbonimidoyl]piperidin-1-yl]methanone (PubChem CID 72642300) has the molecular formula C25H31F3N6O2 and a molecular weight of 504.56 g/mol. Its IUPAC name is [1-[(2-amino-4-pyridinyl)methyl]piperidin-4-yl]-[4-[C-pyridin-2-yl-N-(2,2,2-trifluoroethoxy)carbonimidoyl]piperidin-1-yl]methanone.
| Compound Name | [1-[(2-amino-4-pyridinyl)methyl]piperidin-4-yl]-[4-[C-pyridin-2-yl-N-(2,2,2-trifluoroethoxy)carbonimidoyl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 72642300 |
| Molecular Formula | C25H31F3N6O2 |
| Molecular Weight | 504.56 g/mol |
| Exact Mass | 504.25 |
| IUPAC Name | [1-[(2-amino-4-pyridinyl)methyl]piperidin-4-yl]-[4-[C-pyridin-2-yl-N-(2,2,2-trifluoroethoxy)carbonimidoyl]piperidin-1-yl]methanone |
| SMILES | Nc1cc(CN2CCC(C(=O)N3CCC(C(=NOCC(F)(F)F)c4ccccn4)CC3)CC2)ccn1 |
| InChI | InChI=1S/C25H31F3N6O2/c26-25(27,28)17-36-32-23(21-3-1-2-9-30-21)19-7-13-34(14-8-19)24(35)20-5-11-33(12-6-20)16-18-4-10-31-22(29)15-18/h1-4,9-10,15,19-20H,5-8,11-14,16-17H2,(H2,29,31) |
| InChIKey | RVFIATDXXZBWLZ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 96.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.56 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|