C16H24FN5O — CID 143930920
[1-[(2-amino-4-pyridinyl)methyl]-4-fluoropiperidin-4-yl]-piperazin-1-ylmethanone (PubChem CID 143930920) has the molecular formula C16H24FN5O and a molecular weight of 321.40 g/mol. Its IUPAC name is [1-[(2-amino-4-pyridinyl)methyl]-4-fluoropiperidin-4-yl]-piperazin-1-ylmethanone.
| Compound Name | [1-[(2-amino-4-pyridinyl)methyl]-4-fluoropiperidin-4-yl]-piperazin-1-ylmethanone |
|---|---|
| PubChem CID | 143930920 |
| Molecular Formula | C16H24FN5O |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.20 |
| IUPAC Name | [1-[(2-amino-4-pyridinyl)methyl]-4-fluoropiperidin-4-yl]-piperazin-1-ylmethanone |
| SMILES | Nc1cc(CN2CCC(F)(C(=O)N3CCNCC3)CC2)ccn1 |
| InChI | InChI=1S/C16H24FN5O/c17-16(15(23)22-9-5-19-6-10-22)2-7-21(8-3-16)12-13-1-4-20-14(18)11-13/h1,4,11,19H,2-3,5-10,12H2,(H2,18,20) |
| InChIKey | WWEBSPHOMDFFGM-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |