C26H31F2N5O3 — CID 58334968
[1-[(2-amino-4-pyridinyl)methyl]-4-fluoropiperidin-4-yl]-[(4E)-6-fluoro-4-methoxyiminospiro[3H-chromene-2,4'-piperidine]-1'-yl]methanone (PubChem CID 58334968) has the molecular formula C26H31F2N5O3 and a molecular weight of 499.56 g/mol. Its IUPAC name is [1-[(2-amino-4-pyridinyl)methyl]-4-fluoropiperidin-4-yl]-[(4E)-6-fluoro-4-methoxyiminospiro[3H-chromene-2,4'-piperidine]-1'-yl]methanone.
| Compound Name | [1-[(2-amino-4-pyridinyl)methyl]-4-fluoropiperidin-4-yl]-[(4E)-6-fluoro-4-methoxyiminospiro[3H-chromene-2,4'-piperidine]-1'-yl]methanone |
|---|---|
| PubChem CID | 58334968 |
| Molecular Formula | C26H31F2N5O3 |
| Molecular Weight | 499.56 g/mol |
| Exact Mass | 499.24 |
| IUPAC Name | [1-[(2-amino-4-pyridinyl)methyl]-4-fluoropiperidin-4-yl]-[(4E)-6-fluoro-4-methoxyiminospiro[3H-chromene-2,4'-piperidine]-1'-yl]methanone |
| SMILES | CO/N=C1\CC2(CCN(C(=O)C3(F)CCN(Cc4ccnc(N)c4)CC3)CC2)Oc2ccc(F)cc21 |
| InChI | InChI=1S/C26H31F2N5O3/c1-35-31-21-16-25(36-22-3-2-19(27)15-20(21)22)5-12-33(13-6-25)24(34)26(28)7-10-32(11-8-26)17-18-4-9-30-23(29)14-18/h2-4,9,14-15H,5-8,10-13,16-17H2,1H3,(H2,29,30)/b31-21+ |
| InChIKey | WOQKXBRSZOECOE-NJZRLIGZSA-N |
| XLogP | 3.30 |
| TPSA | 93.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.56 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|