C30H38ClN5O4 — CID 59275091
2-[[(4-chlorophenyl)-[1-[1-(pyridin-4-ylmethyl)piperidine-4-carbonyl]piperidin-4-yl]methylidene]amino]oxy-1-morpholin-4-ylethanone (PubChem CID 59275091) has the molecular formula C30H38ClN5O4 and a molecular weight of 568.12 g/mol. Its IUPAC name is 2-[[(4-chlorophenyl)-[1-[1-(pyridin-4-ylmethyl)piperidine-4-carbonyl]piperidin-4-yl]methylidene]amino]oxy-1-morpholin-4-ylethanone.
| Compound Name | 2-[[(4-chlorophenyl)-[1-[1-(pyridin-4-ylmethyl)piperidine-4-carbonyl]piperidin-4-yl]methylidene]amino]oxy-1-morpholin-4-ylethanone |
|---|---|
| PubChem CID | 59275091 |
| Molecular Formula | C30H38ClN5O4 |
| Molecular Weight | 568.12 g/mol |
| Exact Mass | 567.26 |
| IUPAC Name | 2-[[(4-chlorophenyl)-[1-[1-(pyridin-4-ylmethyl)piperidine-4-carbonyl]piperidin-4-yl]methylidene]amino]oxy-1-morpholin-4-ylethanone |
| SMILES | O=C(CON=C(c1ccc(Cl)cc1)C1CCN(C(=O)C2CCN(Cc3ccncc3)CC2)CC1)N1CCOCC1 |
| InChI | InChI=1S/C30H38ClN5O4/c31-27-3-1-24(2-4-27)29(33-40-22-28(37)35-17-19-39-20-18-35)25-9-15-36(16-10-25)30(38)26-7-13-34(14-8-26)21-23-5-11-32-12-6-23/h1-6,11-12,25-26H,7-10,13-22H2 |
| InChIKey | OLCCSKOTULEHRR-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 87.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.12 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|