C25H37N7O2 — CID 143495974
1-[(2-amino-4-pyridinyl)methyl]piperidine-4-carbaldehyde;(NZ)-N-[2-(6-amino-2-pyridinyl)-1-(1-methylpiperidin-4-yl)ethylidene]hydroxylamine (PubChem CID 143495974) has the molecular formula C25H37N7O2 and a molecular weight of 467.62 g/mol. Its IUPAC name is 1-[(2-amino-4-pyridinyl)methyl]piperidine-4-carbaldehyde;(NZ)-N-[2-(6-amino-2-pyridinyl)-1-(1-methylpiperidin-4-yl)ethylidene]hydroxylamine.
| Compound Name | 1-[(2-amino-4-pyridinyl)methyl]piperidine-4-carbaldehyde;(NZ)-N-[2-(6-amino-2-pyridinyl)-1-(1-methylpiperidin-4-yl)ethylidene]hydroxylamine |
|---|---|
| PubChem CID | 143495974 |
| Molecular Formula | C25H37N7O2 |
| Molecular Weight | 467.62 g/mol |
| Exact Mass | 467.30 |
| IUPAC Name | 1-[(2-amino-4-pyridinyl)methyl]piperidine-4-carbaldehyde;(NZ)-N-[2-(6-amino-2-pyridinyl)-1-(1-methylpiperidin-4-yl)ethylidene]hydroxylamine |
| SMILES | CN1CCC(/C(Cc2cccc(N)n2)=N\O)CC1.Nc1cc(CN2CCC(C=O)CC2)ccn1 |
| InChI | InChI=1S/C13H20N4O.C12H17N3O/c1-17-7-5-10(6-8-17)12(16-18)9-11-3-2-4-13(14)15-11;13-12-7-11(1-4-14-12)8-15-5-2-10(9-16)3-6-15/h2-4,10,18H,5-9H2,1H3,(H2,14,15);1,4,7,9-10H,2-3,5-6,8H2,(H2,13,14)/b16-12-; |
| InChIKey | ILTXLSMWCDQEJY-PXJKFVASSA-N |
| XLogP | 2.45 |
| TPSA | 133.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.62 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|