C12H23Cl2N3O3 — CID 163210129
(6-amino-2-pyridinyl)-(1-methylpiperidin-4-yl)methanone;dihydrate;dihydrochloride (PubChem CID 163210129) has the molecular formula C12H23Cl2N3O3 and a molecular weight of 328.24 g/mol. Its IUPAC name is (6-amino-2-pyridinyl)-(1-methylpiperidin-4-yl)methanone;dihydrate;dihydrochloride.
| Compound Name | (6-amino-2-pyridinyl)-(1-methylpiperidin-4-yl)methanone;dihydrate;dihydrochloride |
|---|---|
| PubChem CID | 163210129 |
| Molecular Formula | C12H23Cl2N3O3 |
| Molecular Weight | 328.24 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | (6-amino-2-pyridinyl)-(1-methylpiperidin-4-yl)methanone;dihydrate;dihydrochloride |
| SMILES | CN1CCC(C(=O)c2cccc(N)n2)CC1.Cl.Cl.O.O |
| InChI | InChI=1S/C12H17N3O.2ClH.2H2O/c1-15-7-5-9(6-8-15)12(16)10-3-2-4-11(13)14-10;;;;/h2-4,9H,5-8H2,1H3,(H2,13,14);2*1H;2*1H2 |
| InChIKey | LZCIRQVUGHMYAI-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 122.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.24 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |