C21H23BrN2O3 — CID 153008612
1-(5-bromo-2-methoxyphenyl)-2-[6-(1-methylpiperidine-4-carbonyl)-2-pyridinyl]ethanone (PubChem CID 153008612) has the molecular formula C21H23BrN2O3 and a molecular weight of 431.33 g/mol. Its IUPAC name is 1-(5-bromo-2-methoxyphenyl)-2-[6-(1-methylpiperidine-4-carbonyl)-2-pyridinyl]ethanone.
| Compound Name | 1-(5-bromo-2-methoxyphenyl)-2-[6-(1-methylpiperidine-4-carbonyl)-2-pyridinyl]ethanone |
|---|---|
| PubChem CID | 153008612 |
| Molecular Formula | C21H23BrN2O3 |
| Molecular Weight | 431.33 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | 1-(5-bromo-2-methoxyphenyl)-2-[6-(1-methylpiperidine-4-carbonyl)-2-pyridinyl]ethanone |
| SMILES | COc1ccc(Br)cc1C(=O)Cc1cccc(C(=O)C2CCN(C)CC2)n1 |
| InChI | InChI=1S/C21H23BrN2O3/c1-24-10-8-14(9-11-24)21(26)18-5-3-4-16(23-18)13-19(25)17-12-15(22)6-7-20(17)27-2/h3-7,12,14H,8-11,13H2,1-2H3 |
| InChIKey | UZPMYOJKGFZUIZ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.33 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |