C23H25ClN4O2S — CID 143496580
1-chloro-2-hydroxysulfanylbenzene;[4-[methyl(pyridin-4-yl)amino]phenyl]-piperazin-1-ylmethanone (PubChem CID 143496580) has the molecular formula C23H25ClN4O2S and a molecular weight of 457.00 g/mol. Its IUPAC name is 1-chloro-2-hydroxysulfanylbenzene;[4-[methyl(pyridin-4-yl)amino]phenyl]-piperazin-1-ylmethanone.
| Compound Name | 1-chloro-2-hydroxysulfanylbenzene;[4-[methyl(pyridin-4-yl)amino]phenyl]-piperazin-1-ylmethanone |
|---|---|
| PubChem CID | 143496580 |
| Molecular Formula | C23H25ClN4O2S |
| Molecular Weight | 457.00 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | 1-chloro-2-hydroxysulfanylbenzene;[4-[methyl(pyridin-4-yl)amino]phenyl]-piperazin-1-ylmethanone |
| SMILES | CN(c1ccncc1)c1ccc(C(=O)N2CCNCC2)cc1.OSc1ccccc1Cl |
| InChI | InChI=1S/C17H20N4O.C6H5ClOS/c1-20(16-6-8-18-9-7-16)15-4-2-14(3-5-15)17(22)21-12-10-19-11-13-21;7-5-3-1-2-4-6(5)9-8/h2-9,19H,10-13H2,1H3;1-4,8H |
| InChIKey | GLDAWYCAFPKZQU-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 68.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.00 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|