C16H22N3O3- — CID 57366155
N-tert-butyl-N-[4-(piperazine-1-carbonyl)phenyl]carbamate (PubChem CID 57366155) has the molecular formula C16H22N3O3- and a molecular weight of 304.37 g/mol. Its IUPAC name is N-tert-butyl-N-[4-(piperazine-1-carbonyl)phenyl]carbamate.
| Compound Name | N-tert-butyl-N-[4-(piperazine-1-carbonyl)phenyl]carbamate |
|---|---|
| PubChem CID | 57366155 |
| Molecular Formula | C16H22N3O3- |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | N-tert-butyl-N-[4-(piperazine-1-carbonyl)phenyl]carbamate |
| SMILES | CC(C)(C)N(C(=O)[O-])c1ccc(C(=O)N2CCNCC2)cc1 |
| InChI | InChI=1S/C16H23N3O3/c1-16(2,3)19(15(21)22)13-6-4-12(5-7-13)14(20)18-10-8-17-9-11-18/h4-7,17H,8-11H2,1-3H3,(H,21,22)/p-1 |
| InChIKey | XAKFURJDDJBBNZ-UHFFFAOYSA-M |
| XLogP | 0.68 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |