C14H17NO — CID 143496867
(3Z,5E)-7-amino-6-methyl-3-phenylhepta-1,3,5-trien-4-ol (PubChem CID 143496867) has the molecular formula C14H17NO and a molecular weight of 215.30 g/mol. Its IUPAC name is (3Z,5E)-7-amino-6-methyl-3-phenylhepta-1,3,5-trien-4-ol.
| Compound Name | (3Z,5E)-7-amino-6-methyl-3-phenylhepta-1,3,5-trien-4-ol |
|---|---|
| PubChem CID | 143496867 |
| Molecular Formula | C14H17NO |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | (3Z,5E)-7-amino-6-methyl-3-phenylhepta-1,3,5-trien-4-ol |
| SMILES | C=C/C(=C(O)\C=C(/C)CN)c1ccccc1 |
| InChI | InChI=1S/C14H17NO/c1-3-13(12-7-5-4-6-8-12)14(16)9-11(2)10-15/h3-9,16H,1,10,15H2,2H3/b11-9+,14-13- |
| InChIKey | JFEHHDHKBJHYNM-FGWKFWITSA-N |
| XLogP | 3.05 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|