C21H21F2N — CID 143497252
(4E,5Z)-4-ethylidene-7-fluoro-3-(4-fluorophenyl)-3-phenylhepta-1,5-dien-2-amine (PubChem CID 143497252) has the molecular formula C21H21F2N and a molecular weight of 325.40 g/mol. Its IUPAC name is (4E,5Z)-4-ethylidene-7-fluoro-3-(4-fluorophenyl)-3-phenylhepta-1,5-dien-2-amine.
| Compound Name | (4E,5Z)-4-ethylidene-7-fluoro-3-(4-fluorophenyl)-3-phenylhepta-1,5-dien-2-amine |
|---|---|
| PubChem CID | 143497252 |
| Molecular Formula | C21H21F2N |
| Molecular Weight | 325.40 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | (4E,5Z)-4-ethylidene-7-fluoro-3-(4-fluorophenyl)-3-phenylhepta-1,5-dien-2-amine |
| SMILES | C=C(N)C(C(/C=C\CF)=C/C)(c1ccccc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H21F2N/c1-3-17(10-7-15-22)21(16(2)24,18-8-5-4-6-9-18)19-11-13-20(23)14-12-19/h3-14H,2,15,24H2,1H3/b10-7-,17-3+ |
| InChIKey | ZALNTBNDGQVKSL-MEJZVGGQSA-N |
| XLogP | 5.06 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.40 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|