C19H34N2S — CID 143497265
ethane;[3-ethyl-5-(imidazol-1-ylmethyl)phenyl]-trimethyl-λ4-sulfane (PubChem CID 143497265) has the molecular formula C19H34N2S and a molecular weight of 322.56 g/mol. Its IUPAC name is ethane;[3-ethyl-5-(imidazol-1-ylmethyl)phenyl]-trimethyl-λ4-sulfane.
| Compound Name | ethane;[3-ethyl-5-(imidazol-1-ylmethyl)phenyl]-trimethyl-λ4-sulfane |
|---|---|
| PubChem CID | 143497265 |
| Molecular Formula | C19H34N2S |
| Molecular Weight | 322.56 g/mol |
| Exact Mass | 322.24 |
| IUPAC Name | ethane;[3-ethyl-5-(imidazol-1-ylmethyl)phenyl]-trimethyl-λ4-sulfane |
| SMILES | CC.CC.CCc1cc(Cn2ccnc2)cc(S(C)(C)C)c1 |
| InChI | InChI=1S/C15H22N2S.2C2H6/c1-5-13-8-14(11-17-7-6-16-12-17)10-15(9-13)18(2,3)4;2*1-2/h6-10,12H,5,11H2,1-4H3;2*1-2H3 |
| InChIKey | XCYFRYYGYIEYRK-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.56 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |