C13H25NS — CID 143498455
3-methyl-1-[(3Z)-4-methylsulfanylbuta-1,3-dien-2-yl]pyrrolidine;propane (PubChem CID 143498455) has the molecular formula C13H25NS and a molecular weight of 227.42 g/mol. Its IUPAC name is 3-methyl-1-[(3Z)-4-methylsulfanylbuta-1,3-dien-2-yl]pyrrolidine;propane.
| Compound Name | 3-methyl-1-[(3Z)-4-methylsulfanylbuta-1,3-dien-2-yl]pyrrolidine;propane |
|---|---|
| PubChem CID | 143498455 |
| Molecular Formula | C13H25NS |
| Molecular Weight | 227.42 g/mol |
| Exact Mass | 227.17 |
| IUPAC Name | 3-methyl-1-[(3Z)-4-methylsulfanylbuta-1,3-dien-2-yl]pyrrolidine;propane |
| SMILES | C=C(/C=C\SC)N1CCC(C)C1.CCC |
| InChI | InChI=1S/C10H17NS.C3H8/c1-9-4-6-11(8-9)10(2)5-7-12-3;1-3-2/h5,7,9H,2,4,6,8H2,1,3H3;3H2,1-2H3/b7-5-; |
| InChIKey | XUZNCCBZNNZWIM-YJOCEBFMSA-N |
| XLogP | 4.13 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.42 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|