C10H18N+ — CID 123698108
1-buta-1,3-dien-2-yl-1,3-dimethylpyrrolidin-1-ium (PubChem CID 123698108) has the molecular formula C10H18N+ and a molecular weight of 152.26 g/mol. Its IUPAC name is 1-buta-1,3-dien-2-yl-1,3-dimethylpyrrolidin-1-ium.
| Compound Name | 1-buta-1,3-dien-2-yl-1,3-dimethylpyrrolidin-1-ium |
|---|---|
| PubChem CID | 123698108 |
| Molecular Formula | C10H18N+ |
| Molecular Weight | 152.26 g/mol |
| Exact Mass | 152.14 |
| IUPAC Name | 1-buta-1,3-dien-2-yl-1,3-dimethylpyrrolidin-1-ium |
| SMILES | C=CC(=C)[N+]1(C)CCC(C)C1 |
| InChI | InChI=1S/C10H18N/c1-5-10(3)11(4)7-6-9(2)8-11/h5,9H,1,3,6-8H2,2,4H3/q+1 |
| InChIKey | GBEMOZWELDRLNA-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.26 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|