C11H16FN — CID 142422467
1-[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]-3-methylpyrrolidine (PubChem CID 142422467) has the molecular formula C11H16FN and a molecular weight of 181.25 g/mol. Its IUPAC name is 1-[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]-3-methylpyrrolidine.
| Compound Name | 1-[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]-3-methylpyrrolidine |
|---|---|
| PubChem CID | 142422467 |
| Molecular Formula | C11H16FN |
| Molecular Weight | 181.25 g/mol |
| Exact Mass | 181.13 |
| IUPAC Name | 1-[(3Z)-5-fluorohexa-1,3,5-trien-2-yl]-3-methylpyrrolidine |
| SMILES | C=C(F)/C=C\C(=C)N1CCC(C)C1 |
| InChI | InChI=1S/C11H16FN/c1-9-6-7-13(8-9)11(3)5-4-10(2)12/h4-5,9H,2-3,6-8H2,1H3/b5-4- |
| InChIKey | AFSADFQSLIDSDE-PLNGDYQASA-N |
| XLogP | 2.88 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.25 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|