C11H16FN — CID 144746560
3-fluoro-1-[(3E)-5-methylhexa-1,3,5-trien-3-yl]pyrrolidine (PubChem CID 144746560) has the molecular formula C11H16FN and a molecular weight of 181.25 g/mol. Its IUPAC name is 3-fluoro-1-[(3E)-5-methylhexa-1,3,5-trien-3-yl]pyrrolidine.
| Compound Name | 3-fluoro-1-[(3E)-5-methylhexa-1,3,5-trien-3-yl]pyrrolidine |
|---|---|
| PubChem CID | 144746560 |
| Molecular Formula | C11H16FN |
| Molecular Weight | 181.25 g/mol |
| Exact Mass | 181.13 |
| IUPAC Name | 3-fluoro-1-[(3E)-5-methylhexa-1,3,5-trien-3-yl]pyrrolidine |
| SMILES | C=C/C(=C\C(=C)C)N1CCC(F)C1 |
| InChI | InChI=1S/C11H16FN/c1-4-11(7-9(2)3)13-6-5-10(12)8-13/h4,7,10H,1-2,5-6,8H2,3H3/b11-7+ |
| InChIKey | OEOGWJCQLOZQDN-YRNVUSSQSA-N |
| XLogP | 2.68 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.25 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|