C11H16FN — CID 142421995
1-[(3E)-4-fluorohexa-1,3,5-trien-2-yl]-3-methylpyrrolidine (PubChem CID 142421995) has the molecular formula C11H16FN and a molecular weight of 181.25 g/mol. Its IUPAC name is 1-[(3E)-4-fluorohexa-1,3,5-trien-2-yl]-3-methylpyrrolidine.
| Compound Name | 1-[(3E)-4-fluorohexa-1,3,5-trien-2-yl]-3-methylpyrrolidine |
|---|---|
| PubChem CID | 142421995 |
| Molecular Formula | C11H16FN |
| Molecular Weight | 181.25 g/mol |
| Exact Mass | 181.13 |
| IUPAC Name | 1-[(3E)-4-fluorohexa-1,3,5-trien-2-yl]-3-methylpyrrolidine |
| SMILES | C=C/C(F)=C\C(=C)N1CCC(C)C1 |
| InChI | InChI=1S/C11H16FN/c1-4-11(12)7-10(3)13-6-5-9(2)8-13/h4,7,9H,1,3,5-6,8H2,2H3/b11-7+ |
| InChIKey | OFLNTFYQDQDVDM-YRNVUSSQSA-N |
| XLogP | 2.88 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.25 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|