C14H22FN — CID 143075769
1-[(3E,5Z)-7-fluorohepta-1,3,5-trien-4-yl]-3-propylpyrrolidine (PubChem CID 143075769) has the molecular formula C14H22FN and a molecular weight of 223.34 g/mol. Its IUPAC name is 1-[(3E,5Z)-7-fluorohepta-1,3,5-trien-4-yl]-3-propylpyrrolidine.
| Compound Name | 1-[(3E,5Z)-7-fluorohepta-1,3,5-trien-4-yl]-3-propylpyrrolidine |
|---|---|
| PubChem CID | 143075769 |
| Molecular Formula | C14H22FN |
| Molecular Weight | 223.34 g/mol |
| Exact Mass | 223.17 |
| IUPAC Name | 1-[(3E,5Z)-7-fluorohepta-1,3,5-trien-4-yl]-3-propylpyrrolidine |
| SMILES | C=C/C=C(\C=C/CF)N1CCC(CCC)C1 |
| InChI | InChI=1S/C14H22FN/c1-3-6-13-9-11-16(12-13)14(7-4-2)8-5-10-15/h4-5,7-8,13H,2-3,6,9-12H2,1H3/b8-5-,14-7+ |
| InChIKey | RYZNZCMLFGHIAK-FWODXUKCSA-N |
| XLogP | 3.70 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.34 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|