C25H26ClN3O3 — CID 143500939
1-azatricyclo[4.2.0.02,8]octane;5-(4-chlorophenyl)-N-[(3-hydroxyphenyl)methyl]-N-methyl-1,2-oxazole-3-carboxamide (PubChem CID 143500939) has the molecular formula C25H26ClN3O3 and a molecular weight of 451.95 g/mol. Its IUPAC name is 1-azatricyclo[4.2.0.02,8]octane;5-(4-chlorophenyl)-N-[(3-hydroxyphenyl)methyl]-N-methyl-1,2-oxazole-3-carboxamide.
| Compound Name | 1-azatricyclo[4.2.0.02,8]octane;5-(4-chlorophenyl)-N-[(3-hydroxyphenyl)methyl]-N-methyl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 143500939 |
| Molecular Formula | C25H26ClN3O3 |
| Molecular Weight | 451.95 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | 1-azatricyclo[4.2.0.02,8]octane;5-(4-chlorophenyl)-N-[(3-hydroxyphenyl)methyl]-N-methyl-1,2-oxazole-3-carboxamide |
| SMILES | C1CC2CC3C(C1)N23.CN(Cc1cccc(O)c1)C(=O)c1cc(-c2ccc(Cl)cc2)on1 |
| InChI | InChI=1S/C18H15ClN2O3.C7H11N/c1-21(11-12-3-2-4-15(22)9-12)18(23)16-10-17(24-20-16)13-5-7-14(19)8-6-13;1-2-5-4-7-6(3-1)8(5)7/h2-10,22H,11H2,1H3;5-7H,1-4H2 |
| InChIKey | WPLWMCXNLLYIAH-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 69.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.95 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|