C8H11NO — CID 143500995
3-methyl-6,7-dihydro-2H-1,3-benzoxazole (PubChem CID 143500995) has the molecular formula C8H11NO and a molecular weight of 137.18 g/mol. Its IUPAC name is 3-methyl-6,7-dihydro-2H-1,3-benzoxazole.
| Compound Name | 3-methyl-6,7-dihydro-2H-1,3-benzoxazole |
|---|---|
| PubChem CID | 143500995 |
| Molecular Formula | C8H11NO |
| Molecular Weight | 137.18 g/mol |
| Exact Mass | 137.08 |
| IUPAC Name | 3-methyl-6,7-dihydro-2H-1,3-benzoxazole |
| SMILES | CN1COC2=C1C=CCC2 |
| InChI | InChI=1S/C8H11NO/c1-9-6-10-8-5-3-2-4-7(8)9/h2,4H,3,5-6H2,1H3 |
| InChIKey | JDWFYSYEYATGMZ-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.18 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |