C10H18INO — CID 143262691
N-ethyl-2-methoxy-N-methylcyclohexa-1,5-dien-1-amine;hydroiodide (PubChem CID 143262691) has the molecular formula C10H18INO and a molecular weight of 295.16 g/mol. Its IUPAC name is N-ethyl-2-methoxy-N-methylcyclohexa-1,5-dien-1-amine;hydroiodide.
| Compound Name | N-ethyl-2-methoxy-N-methylcyclohexa-1,5-dien-1-amine;hydroiodide |
|---|---|
| PubChem CID | 143262691 |
| Molecular Formula | C10H18INO |
| Molecular Weight | 295.16 g/mol |
| Exact Mass | 295.04 |
| IUPAC Name | N-ethyl-2-methoxy-N-methylcyclohexa-1,5-dien-1-amine;hydroiodide |
| SMILES | CCN(C)C1=C(OC)CCC=C1.I |
| InChI | InChI=1S/C10H17NO.HI/c1-4-11(2)9-7-5-6-8-10(9)12-3;/h5,7H,4,6,8H2,1-3H3;1H |
| InChIKey | LDFYQJIYWDSMLD-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.16 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|