About methane;4-methyl-2,3,7,8-tetrahydro-1,4-benzoxazine
methane;4-methyl-2,3,7,8-tetrahydro-1,4-benzoxazine (PubChem CID 145321808) has the molecular formula C10H17NO
and a molecular weight of 167.25 g/mol. Its IUPAC name is methane;4-methyl-2,3,7,8-tetrahydro-1,4-benzoxazine.
Analyze methane;4-methyl-2,3,7,8-tetrahydro-1,4-benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;4-methyl-2,3,7,8-tetrahydro-1,4-benzoxazine?
The IUPAC name of methane;4-methyl-2,3,7,8-tetrahydro-1,4-benzoxazine (CID 145321808) is methane;4-methyl-2,3,7,8-tetrahydro-1,4-benzoxazine.
What is the SMILES notation for methane;4-methyl-2,3,7,8-tetrahydro-1,4-benzoxazine?
The canonical SMILES for methane;4-methyl-2,3,7,8-tetrahydro-1,4-benzoxazine is C.CN1CCOC2=C1C=CCC2.
What is the InChIKey of methane;4-methyl-2,3,7,8-tetrahydro-1,4-benzoxazine?
The InChIKey is SOSDLYCZYGQVQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO.CH4/c1-10-6-7-11-9-5-3-2-4-8(9)10;/h2,4H,3,5-7H2,1H3;1H4.
What are the key properties of methane;4-methyl-2,3,7,8-tetrahydro-1,4-benzoxazine?
methane;4-methyl-2,3,7,8-tetrahydro-1,4-benzoxazine has a molecular weight of 167.25 g/mol, XLogP of 2.15, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methane;4-methyl-2,3,7,8-tetrahydro-1,4-benzoxazine is sourced from PubChem (CID 145321808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).