C12H21NO — CID 170582123
ethane;4-ethyl-2,3,7,8-tetrahydro-1,4-benzoxazine (PubChem CID 170582123) has the molecular formula C12H21NO and a molecular weight of 195.31 g/mol. Its IUPAC name is ethane;4-ethyl-2,3,7,8-tetrahydro-1,4-benzoxazine.
| Compound Name | ethane;4-ethyl-2,3,7,8-tetrahydro-1,4-benzoxazine |
|---|---|
| PubChem CID | 170582123 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | ethane;4-ethyl-2,3,7,8-tetrahydro-1,4-benzoxazine |
| SMILES | CC.CCN1CCOC2=C1C=CCC2 |
| InChI | InChI=1S/C10H15NO.C2H6/c1-2-11-7-8-12-10-6-4-3-5-9(10)11;1-2/h3,5H,2,4,6-8H2,1H3;1-2H3 |
| InChIKey | WTQZVJHRMFFPLQ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |