C24H28N2O2 — CID 143501472
(3Z,5S)-3-[2-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]ethylidene]-5-phenyloxolan-2-one (PubChem CID 143501472) has the molecular formula C24H28N2O2 and a molecular weight of 376.50 g/mol. Its IUPAC name is (3Z,5S)-3-[2-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]ethylidene]-5-phenyloxolan-2-one.
| Compound Name | (3Z,5S)-3-[2-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]ethylidene]-5-phenyloxolan-2-one |
|---|---|
| PubChem CID | 143501472 |
| Molecular Formula | C24H28N2O2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | (3Z,5S)-3-[2-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]ethylidene]-5-phenyloxolan-2-one |
| SMILES | CN1CCN(Cc2ccc(C/C=C3/C[C@@H](c4ccccc4)OC3=O)cc2)CC1 |
| InChI | InChI=1S/C24H28N2O2/c1-25-13-15-26(16-14-25)18-20-9-7-19(8-10-20)11-12-22-17-23(28-24(22)27)21-5-3-2-4-6-21/h2-10,12,23H,11,13-18H2,1H3/b22-12-/t23-/m0/s1 |
| InChIKey | KUZUIEMBTFYOCS-TYBHGIAWSA-N |
| XLogP | 3.59 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|