C30H43FN2O2 — CID 143501527
N-[2-(dimethylamino)ethyl]-3-[4-[(6S)-6-(4-fluorocyclohexyl)-6-hydroxyhexyl]phenyl]-N-methylbenzamide (PubChem CID 143501527) has the molecular formula C30H43FN2O2 and a molecular weight of 482.68 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-3-[4-[(6S)-6-(4-fluorocyclohexyl)-6-hydroxyhexyl]phenyl]-N-methylbenzamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-3-[4-[(6S)-6-(4-fluorocyclohexyl)-6-hydroxyhexyl]phenyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 143501527 |
| Molecular Formula | C30H43FN2O2 |
| Molecular Weight | 482.68 g/mol |
| Exact Mass | 482.33 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-3-[4-[(6S)-6-(4-fluorocyclohexyl)-6-hydroxyhexyl]phenyl]-N-methylbenzamide |
| SMILES | CN(C)CCN(C)C(=O)c1cccc(-c2ccc(CCCCC[C@H](O)C3CCC(F)CC3)cc2)c1 |
| InChI | InChI=1S/C30H43FN2O2/c1-32(2)20-21-33(3)30(35)27-10-7-9-26(22-27)24-14-12-23(13-15-24)8-5-4-6-11-29(34)25-16-18-28(31)19-17-25/h7,9-10,12-15,22,25,28-29,34H,4-6,8,11,16-21H2,1-3H3/t25?,28?,29-/m0/s1 |
| InChIKey | OOJWGZRIUYOKBF-BXOFSMSDSA-N |
| XLogP | 5.98 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.68 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|