C26H31N3OS — CID 143502648
phenyl 1-[3-(3-acetyl-7-methylindol-1-yl)propyl]piperidine-4-carboximidothioate (PubChem CID 143502648) has the molecular formula C26H31N3OS and a molecular weight of 433.62 g/mol. Its IUPAC name is phenyl 1-[3-(3-acetyl-7-methylindol-1-yl)propyl]piperidine-4-carboximidothioate.
| Compound Name | phenyl 1-[3-(3-acetyl-7-methylindol-1-yl)propyl]piperidine-4-carboximidothioate |
|---|---|
| PubChem CID | 143502648 |
| Molecular Formula | C26H31N3OS |
| Molecular Weight | 433.62 g/mol |
| Exact Mass | 433.22 |
| IUPAC Name | phenyl 1-[3-(3-acetyl-7-methylindol-1-yl)propyl]piperidine-4-carboximidothioate |
| SMILES | [H]/N=C(/Sc1ccccc1)C1CCN(CCCn2cc(C(C)=O)c3cccc(C)c32)CC1 |
| InChI | InChI=1S/C26H31N3OS/c1-19-8-6-11-23-24(20(2)30)18-29(25(19)23)15-7-14-28-16-12-21(13-17-28)26(27)31-22-9-4-3-5-10-22/h3-6,8-11,18,21,27H,7,12-17H2,1-2H3/b27-26+ |
| InChIKey | MAUJOQAYDAODQB-CYYJNZCTSA-N |
| XLogP | 6.02 |
| TPSA | 49.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.62 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|