C26H32N2O — CID 143503509
[1-[3-(7-ethyl-3-methylindol-1-yl)propyl]piperidin-4-yl]-phenylmethanone (PubChem CID 143503509) has the molecular formula C26H32N2O and a molecular weight of 388.56 g/mol. Its IUPAC name is [1-[3-(7-ethyl-3-methylindol-1-yl)propyl]piperidin-4-yl]-phenylmethanone.
| Compound Name | [1-[3-(7-ethyl-3-methylindol-1-yl)propyl]piperidin-4-yl]-phenylmethanone |
|---|---|
| PubChem CID | 143503509 |
| Molecular Formula | C26H32N2O |
| Molecular Weight | 388.56 g/mol |
| Exact Mass | 388.25 |
| IUPAC Name | [1-[3-(7-ethyl-3-methylindol-1-yl)propyl]piperidin-4-yl]-phenylmethanone |
| SMILES | CCc1cccc2c(C)cn(CCCN3CCC(C(=O)c4ccccc4)CC3)c12 |
| InChI | InChI=1S/C26H32N2O/c1-3-21-11-7-12-24-20(2)19-28(25(21)24)16-8-15-27-17-13-23(14-18-27)26(29)22-9-5-4-6-10-22/h4-7,9-12,19,23H,3,8,13-18H2,1-2H3 |
| InChIKey | DHGQDKGDMCJWOG-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.56 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |