C34H40Cl2N4O2 — CID 58967876
N-[(3,4-dichlorophenyl)methyl]-7-ethyl-1-[3-[4-(3-phenoxypropyl)piperazin-1-yl]propyl]indole-3-carboxamide (PubChem CID 58967876) has the molecular formula C34H40Cl2N4O2 and a molecular weight of 607.63 g/mol. Its IUPAC name is N-[(3,4-dichlorophenyl)methyl]-7-ethyl-1-[3-[4-(3-phenoxypropyl)piperazin-1-yl]propyl]indole-3-carboxamide.
| Compound Name | N-[(3,4-dichlorophenyl)methyl]-7-ethyl-1-[3-[4-(3-phenoxypropyl)piperazin-1-yl]propyl]indole-3-carboxamide |
|---|---|
| PubChem CID | 58967876 |
| Molecular Formula | C34H40Cl2N4O2 |
| Molecular Weight | 607.63 g/mol |
| Exact Mass | 606.25 |
| IUPAC Name | N-[(3,4-dichlorophenyl)methyl]-7-ethyl-1-[3-[4-(3-phenoxypropyl)piperazin-1-yl]propyl]indole-3-carboxamide |
| SMILES | CCc1cccc2c(C(=O)NCc3ccc(Cl)c(Cl)c3)cn(CCCN3CCN(CCCOc4ccccc4)CC3)c12 |
| InChI | InChI=1S/C34H40Cl2N4O2/c1-2-27-9-6-12-29-30(34(41)37-24-26-13-14-31(35)32(36)23-26)25-40(33(27)29)17-7-15-38-18-20-39(21-19-38)16-8-22-42-28-10-4-3-5-11-28/h3-6,9-14,23,25H,2,7-8,15-22,24H2,1H3,(H,37,41) |
| InChIKey | UVXMKFMTPSNFBB-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 49.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.63 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|