C26H37N3O2 — CID 143503105
(E)-3-[3-(aminomethyl)phenyl]-4-(methylamino)but-3-en-2-one;1-ethyl-3-(4-methylphenoxy)piperidine (PubChem CID 143503105) has the molecular formula C26H37N3O2 and a molecular weight of 423.60 g/mol. Its IUPAC name is (E)-3-[3-(aminomethyl)phenyl]-4-(methylamino)but-3-en-2-one;1-ethyl-3-(4-methylphenoxy)piperidine.
| Compound Name | (E)-3-[3-(aminomethyl)phenyl]-4-(methylamino)but-3-en-2-one;1-ethyl-3-(4-methylphenoxy)piperidine |
|---|---|
| PubChem CID | 143503105 |
| Molecular Formula | C26H37N3O2 |
| Molecular Weight | 423.60 g/mol |
| Exact Mass | 423.29 |
| IUPAC Name | (E)-3-[3-(aminomethyl)phenyl]-4-(methylamino)but-3-en-2-one;1-ethyl-3-(4-methylphenoxy)piperidine |
| SMILES | CCN1CCCC(Oc2ccc(C)cc2)C1.CN/C=C(/C(C)=O)c1cccc(CN)c1 |
| InChI | InChI=1S/C14H21NO.C12H16N2O/c1-3-15-10-4-5-14(11-15)16-13-8-6-12(2)7-9-13;1-9(15)12(8-14-2)11-5-3-4-10(6-11)7-13/h6-9,14H,3-5,10-11H2,1-2H3;3-6,8,14H,7,13H2,1-2H3/b;12-8- |
| InChIKey | VWFVWEREIKBPSX-XGFRQXOSSA-N |
| XLogP | 4.15 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.60 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|