C16H24N2O5 — CID 143504535
methyl 1-[[2-[[(2Z)-2-methoxypenta-2,4-dienoyl]amino]acetyl]amino]cyclohexane-1-carboxylate (PubChem CID 143504535) has the molecular formula C16H24N2O5 and a molecular weight of 324.38 g/mol. Its IUPAC name is methyl 1-[[2-[[(2Z)-2-methoxypenta-2,4-dienoyl]amino]acetyl]amino]cyclohexane-1-carboxylate.
| Compound Name | methyl 1-[[2-[[(2Z)-2-methoxypenta-2,4-dienoyl]amino]acetyl]amino]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 143504535 |
| Molecular Formula | C16H24N2O5 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | methyl 1-[[2-[[(2Z)-2-methoxypenta-2,4-dienoyl]amino]acetyl]amino]cyclohexane-1-carboxylate |
| SMILES | C=C/C=C(\OC)C(=O)NCC(=O)NC1(C(=O)OC)CCCCC1 |
| InChI | InChI=1S/C16H24N2O5/c1-4-8-12(22-2)14(20)17-11-13(19)18-16(15(21)23-3)9-6-5-7-10-16/h4,8H,1,5-7,9-11H2,2-3H3,(H,17,20)(H,18,19)/b12-8- |
| InChIKey | QTLWDJNYHMRCTP-WQLSENKSSA-N |
| XLogP | 0.81 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|