C15H22N2O5 — CID 143504884
1-[[2-[[(2Z)-2-methoxypenta-2,4-dienoyl]amino]acetyl]amino]cyclohexane-1-carboxylic acid (PubChem CID 143504884) has the molecular formula C15H22N2O5 and a molecular weight of 310.35 g/mol. Its IUPAC name is 1-[[2-[[(2Z)-2-methoxypenta-2,4-dienoyl]amino]acetyl]amino]cyclohexane-1-carboxylic acid.
| Compound Name | 1-[[2-[[(2Z)-2-methoxypenta-2,4-dienoyl]amino]acetyl]amino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 143504884 |
| Molecular Formula | C15H22N2O5 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | 1-[[2-[[(2Z)-2-methoxypenta-2,4-dienoyl]amino]acetyl]amino]cyclohexane-1-carboxylic acid |
| SMILES | C=C/C=C(\OC)C(=O)NCC(=O)NC1(C(=O)O)CCCCC1 |
| InChI | InChI=1S/C15H22N2O5/c1-3-7-11(22-2)13(19)16-10-12(18)17-15(14(20)21)8-5-4-6-9-15/h3,7H,1,4-6,8-10H2,2H3,(H,16,19)(H,17,18)(H,20,21)/b11-7- |
| InChIKey | FWAZAAQYWHAALM-XFFZJAGNSA-N |
| XLogP | 0.72 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|