C13H28N2O3 — CID 143505919
ethane;4-[2-(2-methoxyethoxy)ethyl]-1-methyl-1,4-diazepan-5-one (PubChem CID 143505919) has the molecular formula C13H28N2O3 and a molecular weight of 260.38 g/mol. Its IUPAC name is ethane;4-[2-(2-methoxyethoxy)ethyl]-1-methyl-1,4-diazepan-5-one.
| Compound Name | ethane;4-[2-(2-methoxyethoxy)ethyl]-1-methyl-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 143505919 |
| Molecular Formula | C13H28N2O3 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.21 |
| IUPAC Name | ethane;4-[2-(2-methoxyethoxy)ethyl]-1-methyl-1,4-diazepan-5-one |
| SMILES | CC.COCCOCCN1CCN(C)CCC1=O |
| InChI | InChI=1S/C11H22N2O3.C2H6/c1-12-4-3-11(14)13(6-5-12)7-8-16-10-9-15-2;1-2/h3-10H2,1-2H3;1-2H3 |
| InChIKey | OMQBPTVRXYGKHN-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|