C21H22F3N3O4 — CID 143506265
(Z)-N-[3-(6-amino-6-oxohexoxy)-4-(trifluoromethyl)phenyl]-2-cyano-3-hydroxyhept-2-en-6-ynamide (PubChem CID 143506265) has the molecular formula C21H22F3N3O4 and a molecular weight of 437.42 g/mol. Its IUPAC name is (Z)-N-[3-(6-amino-6-oxohexoxy)-4-(trifluoromethyl)phenyl]-2-cyano-3-hydroxyhept-2-en-6-ynamide.
| Compound Name | (Z)-N-[3-(6-amino-6-oxohexoxy)-4-(trifluoromethyl)phenyl]-2-cyano-3-hydroxyhept-2-en-6-ynamide |
|---|---|
| PubChem CID | 143506265 |
| Molecular Formula | C21H22F3N3O4 |
| Molecular Weight | 437.42 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | (Z)-N-[3-(6-amino-6-oxohexoxy)-4-(trifluoromethyl)phenyl]-2-cyano-3-hydroxyhept-2-en-6-ynamide |
| SMILES | C#CCC/C(O)=C(\C#N)C(=O)Nc1ccc(C(F)(F)F)c(OCCCCCC(N)=O)c1 |
| InChI | InChI=1S/C21H22F3N3O4/c1-2-3-7-17(28)15(13-25)20(30)27-14-9-10-16(21(22,23)24)18(12-14)31-11-6-4-5-8-19(26)29/h1,9-10,12,28H,3-8,11H2,(H2,26,29)(H,27,30)/b17-15- |
| InChIKey | QVMQZTTUZDZFNS-ICFOKQHNSA-N |
| XLogP | 3.82 |
| TPSA | 125.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.42 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|