C16H12F3N3O4 — CID 162357428
(Z)-2-cyano-3-hydroxy-N-[3-methoxy-4-(trifluoromethyl)phenyl]-3-(5-methyl-1,2-oxazol-4-yl)prop-2-enamide (PubChem CID 162357428) has the molecular formula C16H12F3N3O4 and a molecular weight of 367.28 g/mol. Its IUPAC name is (Z)-2-cyano-3-hydroxy-N-[3-methoxy-4-(trifluoromethyl)phenyl]-3-(5-methyl-1,2-oxazol-4-yl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-hydroxy-N-[3-methoxy-4-(trifluoromethyl)phenyl]-3-(5-methyl-1,2-oxazol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 162357428 |
| Molecular Formula | C16H12F3N3O4 |
| Molecular Weight | 367.28 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | (Z)-2-cyano-3-hydroxy-N-[3-methoxy-4-(trifluoromethyl)phenyl]-3-(5-methyl-1,2-oxazol-4-yl)prop-2-enamide |
| SMILES | COc1cc(NC(=O)/C(C#N)=C(\O)c2cnoc2C)ccc1C(F)(F)F |
| InChI | InChI=1S/C16H12F3N3O4/c1-8-11(7-21-26-8)14(23)10(6-20)15(24)22-9-3-4-12(16(17,18)19)13(5-9)25-2/h3-5,7,23H,1-2H3,(H,22,24)/b14-10- |
| InChIKey | HCRFSERVXQZGRR-UVTDQMKNSA-N |
| XLogP | 3.44 |
| TPSA | 108.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.28 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|