C19H14N6O4 — CID 162357484
2-[[(Z)-2-cyano-3-hydroxy-3-(5-methyl-1,2-oxazol-4-yl)prop-2-enoyl]amino]-N-phenylpyrimidine-5-carboxamide (PubChem CID 162357484) has the molecular formula C19H14N6O4 and a molecular weight of 390.36 g/mol. Its IUPAC name is 2-[[(Z)-2-cyano-3-hydroxy-3-(5-methyl-1,2-oxazol-4-yl)prop-2-enoyl]amino]-N-phenylpyrimidine-5-carboxamide.
| Compound Name | 2-[[(Z)-2-cyano-3-hydroxy-3-(5-methyl-1,2-oxazol-4-yl)prop-2-enoyl]amino]-N-phenylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 162357484 |
| Molecular Formula | C19H14N6O4 |
| Molecular Weight | 390.36 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | 2-[[(Z)-2-cyano-3-hydroxy-3-(5-methyl-1,2-oxazol-4-yl)prop-2-enoyl]amino]-N-phenylpyrimidine-5-carboxamide |
| SMILES | Cc1oncc1/C(O)=C(\C#N)C(=O)Nc1ncc(C(=O)Nc2ccccc2)cn1 |
| InChI | InChI=1S/C19H14N6O4/c1-11-15(10-23-29-11)16(26)14(7-20)18(28)25-19-21-8-12(9-22-19)17(27)24-13-5-3-2-4-6-13/h2-6,8-10,26H,1H3,(H,24,27)(H,21,22,25,28)/b16-14- |
| InChIKey | PZPJAGCDGIDQCC-PEZBUJJGSA-N |
| XLogP | 2.46 |
| TPSA | 154.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.36 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|