C15H12ClN3O5S — CID 162357307
(Z)-N-(2-chloro-4-methylsulfonylphenyl)-2-cyano-3-hydroxy-3-(5-methyl-1,2-oxazol-4-yl)prop-2-enamide (PubChem CID 162357307) has the molecular formula C15H12ClN3O5S and a molecular weight of 381.80 g/mol. Its IUPAC name is (Z)-N-(2-chloro-4-methylsulfonylphenyl)-2-cyano-3-hydroxy-3-(5-methyl-1,2-oxazol-4-yl)prop-2-enamide.
| Compound Name | (Z)-N-(2-chloro-4-methylsulfonylphenyl)-2-cyano-3-hydroxy-3-(5-methyl-1,2-oxazol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 162357307 |
| Molecular Formula | C15H12ClN3O5S |
| Molecular Weight | 381.80 g/mol |
| Exact Mass | 381.02 |
| IUPAC Name | (Z)-N-(2-chloro-4-methylsulfonylphenyl)-2-cyano-3-hydroxy-3-(5-methyl-1,2-oxazol-4-yl)prop-2-enamide |
| SMILES | Cc1oncc1/C(O)=C(\C#N)C(=O)Nc1ccc(S(C)(=O)=O)cc1Cl |
| InChI | InChI=1S/C15H12ClN3O5S/c1-8-11(7-18-24-8)14(20)10(6-17)15(21)19-13-4-3-9(5-12(13)16)25(2,22)23/h3-5,7,20H,1-2H3,(H,19,21)/b14-10- |
| InChIKey | NRHADAXIOITOIN-UVTDQMKNSA-N |
| XLogP | 2.47 |
| TPSA | 133.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.80 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|