C16H15N5O5S — CID 162357186
(Z)-2-cyano-3-hydroxy-N-(4-methyl-6,6-dioxo-7,8-dihydro-5H-thiopyrano[4,3-d]pyrimidin-2-yl)-3-(5-methyl-1,2-oxazol-4-yl)prop-2-enamide (PubChem CID 162357186) has the molecular formula C16H15N5O5S and a molecular weight of 389.39 g/mol. Its IUPAC name is (Z)-2-cyano-3-hydroxy-N-(4-methyl-6,6-dioxo-7,8-dihydro-5H-thiopyrano[4,3-d]pyrimidin-2-yl)-3-(5-methyl-1,2-oxazol-4-yl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-hydroxy-N-(4-methyl-6,6-dioxo-7,8-dihydro-5H-thiopyrano[4,3-d]pyrimidin-2-yl)-3-(5-methyl-1,2-oxazol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 162357186 |
| Molecular Formula | C16H15N5O5S |
| Molecular Weight | 389.39 g/mol |
| Exact Mass | 389.08 |
| IUPAC Name | (Z)-2-cyano-3-hydroxy-N-(4-methyl-6,6-dioxo-7,8-dihydro-5H-thiopyrano[4,3-d]pyrimidin-2-yl)-3-(5-methyl-1,2-oxazol-4-yl)prop-2-enamide |
| SMILES | Cc1nc(NC(=O)/C(C#N)=C(\O)c2cnoc2C)nc2c1CS(=O)(=O)CC2 |
| InChI | InChI=1S/C16H15N5O5S/c1-8-12-7-27(24,25)4-3-13(12)20-16(19-8)21-15(23)10(5-17)14(22)11-6-18-26-9(11)2/h6,22H,3-4,7H2,1-2H3,(H,19,20,21,23)/b14-10- |
| InChIKey | GCKGJPHZGJJZJE-UVTDQMKNSA-N |
| XLogP | 0.98 |
| TPSA | 159.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.39 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|