C15H14ClNO4S — CID 145271067
N-(2-chloro-4-methylsulfonylphenyl)-2-hydroxy-5-methylbenzamide (PubChem CID 145271067) has the molecular formula C15H14ClNO4S and a molecular weight of 339.80 g/mol. Its IUPAC name is N-(2-chloro-4-methylsulfonylphenyl)-2-hydroxy-5-methylbenzamide.
| Compound Name | N-(2-chloro-4-methylsulfonylphenyl)-2-hydroxy-5-methylbenzamide |
|---|---|
| PubChem CID | 145271067 |
| Molecular Formula | C15H14ClNO4S |
| Molecular Weight | 339.80 g/mol |
| Exact Mass | 339.03 |
| IUPAC Name | N-(2-chloro-4-methylsulfonylphenyl)-2-hydroxy-5-methylbenzamide |
| SMILES | Cc1ccc(O)c(C(=O)Nc2ccc(S(C)(=O)=O)cc2Cl)c1 |
| InChI | InChI=1S/C15H14ClNO4S/c1-9-3-6-14(18)11(7-9)15(19)17-13-5-4-10(8-12(13)16)22(2,20)21/h3-8,18H,1-2H3,(H,17,19) |
| InChIKey | QUGCWZXADWUSEA-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.80 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |