C15H14ClNO6S2 — CID 71381199
N-[2,4-bis(methylsulfonyl)phenyl]-5-chloro-2-hydroxybenzamide (PubChem CID 71381199) has the molecular formula C15H14ClNO6S2 and a molecular weight of 403.87 g/mol. Its IUPAC name is N-[2,4-bis(methylsulfonyl)phenyl]-5-chloro-2-hydroxybenzamide.
| Compound Name | N-[2,4-bis(methylsulfonyl)phenyl]-5-chloro-2-hydroxybenzamide |
|---|---|
| PubChem CID | 71381199 |
| Molecular Formula | C15H14ClNO6S2 |
| Molecular Weight | 403.87 g/mol |
| Exact Mass | 403.00 |
| IUPAC Name | N-[2,4-bis(methylsulfonyl)phenyl]-5-chloro-2-hydroxybenzamide |
| SMILES | CS(=O)(=O)c1ccc(NC(=O)c2cc(Cl)ccc2O)c(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C15H14ClNO6S2/c1-24(20,21)10-4-5-12(14(8-10)25(2,22)23)17-15(19)11-7-9(16)3-6-13(11)18/h3-8,18H,1-2H3,(H,17,19) |
| InChIKey | BSKQAAOGJIFFII-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 117.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.87 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |