C14H13F2N3O5 — CID 143507448
3-[4-(1,1-difluoroprop-2-enoxy)-3-nitrophenyl]-5,5-dimethylimidazolidine-2,4-dione (PubChem CID 143507448) has the molecular formula C14H13F2N3O5 and a molecular weight of 341.27 g/mol. Its IUPAC name is 3-[4-(1,1-difluoroprop-2-enoxy)-3-nitrophenyl]-5,5-dimethylimidazolidine-2,4-dione.
| Compound Name | 3-[4-(1,1-difluoroprop-2-enoxy)-3-nitrophenyl]-5,5-dimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 143507448 |
| Molecular Formula | C14H13F2N3O5 |
| Molecular Weight | 341.27 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | 3-[4-(1,1-difluoroprop-2-enoxy)-3-nitrophenyl]-5,5-dimethylimidazolidine-2,4-dione |
| SMILES | C=CC(F)(F)Oc1ccc(N2C(=O)NC(C)(C)C2=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H13F2N3O5/c1-4-14(15,16)24-10-6-5-8(7-9(10)19(22)23)18-11(20)13(2,3)17-12(18)21/h4-7H,1H2,2-3H3,(H,17,21) |
| InChIKey | CULOXDRTBPLXGF-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.27 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|